C26H21F3N4O3S — CID 174705090
[2,3-dihydro-1H-inden-5-yl-hydroxy-[5-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]methyl] formate (PubChem CID 174705090) has the molecular formula C26H21F3N4O3S and a molecular weight of 526.54 g/mol. Its IUPAC name is [2,3-dihydro-1H-inden-5-yl-hydroxy-[5-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]methyl] formate.
| Compound Name | [2,3-dihydro-1H-inden-5-yl-hydroxy-[5-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]methyl] formate |
|---|---|
| PubChem CID | 174705090 |
| Molecular Formula | C26H21F3N4O3S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | [2,3-dihydro-1H-inden-5-yl-hydroxy-[5-[4-methyl-6-[[4-(trifluoromethyl)-2-pyridinyl]amino]-2-pyridinyl]-1,3-thiazol-2-yl]methyl] formate |
| SMILES | Cc1cc(Nc2cc(C(F)(F)F)ccn2)nc(-c2cnc(C(O)(OC=O)c3ccc4c(c3)CCC4)s2)c1 |
| InChI | InChI=1S/C26H21F3N4O3S/c1-15-9-20(32-23(10-15)33-22-12-19(7-8-30-22)26(27,28)29)21-13-31-24(37-21)25(35,36-14-34)18-6-5-16-3-2-4-17(16)11-18/h5-14,35H,2-4H2,1H3,(H,30,32,33) |
| InChIKey | PVJRPGDOFFOXDW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|