About 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea
1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea (PubChem CID 174705462) has the molecular formula C17H21FN4O5S
and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea.
Molecular Properties
| Compound Name | 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea |
| PubChem CID | 174705462 |
| Molecular Formula | C17H21FN4O5S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea |
| SMILES | COc1cc(NC(=O)NS(=O)(=O)N(c2ccc(F)cc2)C(C)C)nc(OC)c1 |
| InChI | InChI=1S/C17H21FN4O5S/c1-11(2)22(13-7-5-12(18)6-8-13)28(24,25)21-17(23)20-15-9-14(26-3)10-16(19-15)27-4/h5-11H,1-4H3,(H2,19,20,21,23) |
| InChIKey | HYSQFNOLUJPDIL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea?
The IUPAC name of 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea (CID 174705462) is 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea.
What is the SMILES notation for 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea?
The canonical SMILES for 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea is COc1cc(NC(=O)NS(=O)(=O)N(c2ccc(F)cc2)C(C)C)nc(OC)c1.
What is the InChIKey of 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea?
The InChIKey is HYSQFNOLUJPDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FN4O5S/c1-11(2)22(13-7-5-12(18)6-8-13)28(24,25)21-17(23)20-15-9-14(26-3)10-16(19-15)27-4/h5-11H,1-4H3,(H2,19,20,21,23).
What are the key properties of 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea?
1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea has a molecular weight of 412.44 g/mol, XLogP of 2.52, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethoxy-2-pyridinyl)-3-[(4-fluorophenyl)-propan-2-ylsulfamoyl]urea is sourced from PubChem (CID 174705462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).