About 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride
2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride (PubChem CID 174705488) has the molecular formula C10H15ClN2O2
and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride |
| PubChem CID | 174705488 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride |
| SMILES | Cl.Nc1cccc(N)c1CC1COCO1 |
| InChI | InChI=1S/C10H14N2O2.ClH/c11-9-2-1-3-10(12)8(9)4-7-5-13-6-14-7;/h1-3,7H,4-6,11-12H2;1H |
| InChIKey | AWOQBFOQVAZZQM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride?
The IUPAC name of 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride (CID 174705488) is 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride.
What is the SMILES notation for 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride?
The canonical SMILES for 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride is Cl.Nc1cccc(N)c1CC1COCO1.
What is the InChIKey of 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride?
The InChIKey is AWOQBFOQVAZZQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2.ClH/c11-9-2-1-3-10(12)8(9)4-7-5-13-6-14-7;/h1-3,7H,4-6,11-12H2;1H.
What are the key properties of 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride?
2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride has a molecular weight of 230.69 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-4-ylmethyl)benzene-1,3-diamine;hydrochloride is sourced from PubChem (CID 174705488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).