About 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane
4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane (PubChem CID 174706087) has the molecular formula C19H40O3Si
and a molecular weight of 344.61 g/mol. Its IUPAC name is 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane.
Molecular Properties
| Compound Name | 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane |
| PubChem CID | 174706087 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane |
| SMILES | C=CCC(C)C.CCOC1(CC)CCCC[Si]1(OCC)OCC |
| InChI | InChI=1S/C13H28O3Si.C6H12/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;1-4-5-6(2)3/h5-12H2,1-4H3;4,6H,1,5H2,2-3H3 |
| InChIKey | YFCGKBDQQMWZFB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane?
The IUPAC name of 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane (CID 174706087) is 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane.
What is the SMILES notation for 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane?
The canonical SMILES for 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane is C=CCC(C)C.CCOC1(CC)CCCC[Si]1(OCC)OCC.
What is the InChIKey of 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane?
The InChIKey is YFCGKBDQQMWZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3Si.C6H12/c1-5-13(14-6-2)11-9-10-12-17(13,15-7-3)16-8-4;1-4-5-6(2)3/h5-12H2,1-4H3;4,6H,1,5H2,2-3H3.
What are the key properties of 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane?
4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane has a molecular weight of 344.61 g/mol, XLogP of 5.63, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpent-1-ene;1,1,2-triethoxy-2-ethylsilinane is sourced from PubChem (CID 174706087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).