About 1-iodo-2,5-dihydropyrrole-2-carboxylic acid
1-iodo-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 174706654) has the molecular formula C5H6INO2
and a molecular weight of 239.01 g/mol. Its IUPAC name is 1-iodo-2,5-dihydropyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-iodo-2,5-dihydropyrrole-2-carboxylic acid |
| PubChem CID | 174706654 |
| Molecular Formula | C5H6INO2 |
| Molecular Weight | 239.01 g/mol |
| Exact Mass | 238.94 |
| IUPAC Name | 1-iodo-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | O=C(O)C1C=CCN1I |
| InChI | InChI=1S/C5H6INO2/c6-7-3-1-2-4(7)5(8)9/h1-2,4H,3H2,(H,8,9) |
| InChIKey | BBPLOPPPFZAOEX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.01 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2,5-dihydropyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2,5-dihydropyrrole-2-carboxylic acid?
The IUPAC name of 1-iodo-2,5-dihydropyrrole-2-carboxylic acid (CID 174706654) is 1-iodo-2,5-dihydropyrrole-2-carboxylic acid.
What is the SMILES notation for 1-iodo-2,5-dihydropyrrole-2-carboxylic acid?
The canonical SMILES for 1-iodo-2,5-dihydropyrrole-2-carboxylic acid is O=C(O)C1C=CCN1I.
What is the InChIKey of 1-iodo-2,5-dihydropyrrole-2-carboxylic acid?
The InChIKey is BBPLOPPPFZAOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6INO2/c6-7-3-1-2-4(7)5(8)9/h1-2,4H,3H2,(H,8,9).
What are the key properties of 1-iodo-2,5-dihydropyrrole-2-carboxylic acid?
1-iodo-2,5-dihydropyrrole-2-carboxylic acid has a molecular weight of 239.01 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2,5-dihydropyrrole-2-carboxylic acid is sourced from PubChem (CID 174706654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).