About 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate
3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate (PubChem CID 174707112) has the molecular formula C14H17F3O3
and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate.
Molecular Properties
| Compound Name | 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate |
| PubChem CID | 174707112 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate |
| SMILES | CCCC(=O)OCCCC1=CC=C(C(F)(F)F)C(=O)C1 |
| InChI | InChI=1S/C14H17F3O3/c1-2-4-13(19)20-8-3-5-10-6-7-11(12(18)9-10)14(15,16)17/h6-7H,2-5,8-9H2,1H3 |
| InChIKey | AOATYCLVRDIADC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate?
The IUPAC name of 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate (CID 174707112) is 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate.
What is the SMILES notation for 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate?
The canonical SMILES for 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate is CCCC(=O)OCCCC1=CC=C(C(F)(F)F)C(=O)C1.
What is the InChIKey of 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate?
The InChIKey is AOATYCLVRDIADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F3O3/c1-2-4-13(19)20-8-3-5-10-6-7-11(12(18)9-10)14(15,16)17/h6-7H,2-5,8-9H2,1H3.
What are the key properties of 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate?
3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate has a molecular weight of 290.28 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-oxo-4-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]propyl butanoate is sourced from PubChem (CID 174707112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).