About 2-bromo-1,1-dichloroethene;hydrochloride
2-bromo-1,1-dichloroethene;hydrochloride (PubChem CID 174707221) has the molecular formula C2H2BrCl3
and a molecular weight of 212.30 g/mol. Its IUPAC name is 2-bromo-1,1-dichloroethene;hydrochloride.
Molecular Properties
| Compound Name | 2-bromo-1,1-dichloroethene;hydrochloride |
| PubChem CID | 174707221 |
| Molecular Formula | C2H2BrCl3 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 209.84 |
| IUPAC Name | 2-bromo-1,1-dichloroethene;hydrochloride |
| SMILES | Cl.ClC(Cl)=CBr |
| InChI | InChI=1S/C2HBrCl2.ClH/c3-1-2(4)5;/h1H;1H |
| InChIKey | NAYFNSCBJQYZKA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-1,1-dichloroethene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,1-dichloroethene;hydrochloride?
The IUPAC name of 2-bromo-1,1-dichloroethene;hydrochloride (CID 174707221) is 2-bromo-1,1-dichloroethene;hydrochloride.
What is the SMILES notation for 2-bromo-1,1-dichloroethene;hydrochloride?
The canonical SMILES for 2-bromo-1,1-dichloroethene;hydrochloride is Cl.ClC(Cl)=CBr.
What is the InChIKey of 2-bromo-1,1-dichloroethene;hydrochloride?
The InChIKey is NAYFNSCBJQYZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HBrCl2.ClH/c3-1-2(4)5;/h1H;1H.
What are the key properties of 2-bromo-1,1-dichloroethene;hydrochloride?
2-bromo-1,1-dichloroethene;hydrochloride has a molecular weight of 212.30 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,1-dichloroethene;hydrochloride is sourced from PubChem (CID 174707221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).