About 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione)
3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) (PubChem CID 174708044) has the molecular formula C19H15N3O8
and a molecular weight of 413.34 g/mol. Its IUPAC name is 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione).
Molecular Properties
| Compound Name | 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) |
| PubChem CID | 174708044 |
| Molecular Formula | C19H15N3O8 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) |
| SMILES | O=C(c1ccccc1)C1CC(=O)N(O)C1=O.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C11H9NO4.2C4H3NO2/c13-9-6-8(11(15)12(9)16)10(14)7-4-2-1-3-5-7;2*6-3-1-2-4(7)5-3/h1-5,8,16H,6H2;2*1-2H,(H,5,6,7) |
| InChIKey | YRNDYMNTYIDFLS-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione)?
The IUPAC name of 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) (CID 174708044) is 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione).
What is the SMILES notation for 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione)?
The canonical SMILES for 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) is O=C(c1ccccc1)C1CC(=O)N(O)C1=O.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.
What is the InChIKey of 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione)?
The InChIKey is YRNDYMNTYIDFLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO4.2C4H3NO2/c13-9-6-8(11(15)12(9)16)10(14)7-4-2-1-3-5-7;2*6-3-1-2-4(7)5-3/h1-5,8,16H,6H2;2*1-2H,(H,5,6,7).
What are the key properties of 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione)?
3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) has a molecular weight of 413.34 g/mol, XLogP of -0.97, 2 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-1-hydroxypyrrolidine-2,5-dione;bis(pyrrole-2,5-dione) is sourced from PubChem (CID 174708044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).