About alumane;chloro hydrogen sulfate;iron
alumane;chloro hydrogen sulfate;iron (PubChem CID 174709117) has the molecular formula H4AlClFeO4S
and a molecular weight of 218.38 g/mol. Its IUPAC name is alumane;chloro hydrogen sulfate;iron.
Molecular Properties
| Compound Name | alumane;chloro hydrogen sulfate;iron |
| PubChem CID | 174709117 |
| Molecular Formula | H4AlClFeO4S |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 217.87 |
| IUPAC Name | alumane;chloro hydrogen sulfate;iron |
| SMILES | O=S(=O)(O)OCl.[AlH3].[Fe] |
| InChI | InChI=1S/Al.ClHO4S.Fe.3H/c;1-5-6(2,3)4;;;;/h;(H,2,3,4);;;; |
| InChIKey | BGHDOMCCAGHZNF-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze alumane;chloro hydrogen sulfate;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;chloro hydrogen sulfate;iron?
The IUPAC name of alumane;chloro hydrogen sulfate;iron (CID 174709117) is alumane;chloro hydrogen sulfate;iron.
What is the SMILES notation for alumane;chloro hydrogen sulfate;iron?
The canonical SMILES for alumane;chloro hydrogen sulfate;iron is O=S(=O)(O)OCl.[AlH3].[Fe].
What is the InChIKey of alumane;chloro hydrogen sulfate;iron?
The InChIKey is BGHDOMCCAGHZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/Al.ClHO4S.Fe.3H/c;1-5-6(2,3)4;;;;/h;(H,2,3,4);;;;.
What are the key properties of alumane;chloro hydrogen sulfate;iron?
alumane;chloro hydrogen sulfate;iron has a molecular weight of 218.38 g/mol, XLogP of -1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;chloro hydrogen sulfate;iron is sourced from PubChem (CID 174709117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).