About 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium
6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium (PubChem CID 174709527) has the molecular formula C16H15Cl2NO
and a molecular weight of 308.21 g/mol. Its IUPAC name is 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium.
Molecular Properties
| Compound Name | 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium |
| PubChem CID | 174709527 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium |
| SMILES | Cc1cc2c(cc1Cl)[N+](C)([O-])CC2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-10-7-13-14(11-3-5-12(17)6-4-11)9-19(2,20)16(13)8-15(10)18/h3-8,14H,9H2,1-2H3 |
| InChIKey | NWTLNPNXGFPSOR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium?
The IUPAC name of 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium (CID 174709527) is 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium.
What is the SMILES notation for 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium?
The canonical SMILES for 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium is Cc1cc2c(cc1Cl)[N+](C)([O-])CC2c1ccc(Cl)cc1.
What is the InChIKey of 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium?
The InChIKey is NWTLNPNXGFPSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO/c1-10-7-13-14(11-3-5-12(17)6-4-11)9-19(2,20)16(13)8-15(10)18/h3-8,14H,9H2,1-2H3.
What are the key properties of 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium?
6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium has a molecular weight of 308.21 g/mol, XLogP of 4.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-(4-chlorophenyl)-1,5-dimethyl-1-oxido-2,3-dihydroindol-1-ium is sourced from PubChem (CID 174709527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).