About 5-chloro-1,2-thiazole-3,4-dicarbohydrazide
5-chloro-1,2-thiazole-3,4-dicarbohydrazide (PubChem CID 174710009) has the molecular formula C5H6ClN5O2S
and a molecular weight of 235.66 g/mol. Its IUPAC name is 5-chloro-1,2-thiazole-3,4-dicarbohydrazide.
Molecular Properties
| Compound Name | 5-chloro-1,2-thiazole-3,4-dicarbohydrazide |
| PubChem CID | 174710009 |
| Molecular Formula | C5H6ClN5O2S |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 5-chloro-1,2-thiazole-3,4-dicarbohydrazide |
| SMILES | NNC(=O)c1nsc(Cl)c1C(=O)NN |
| InChI | InChI=1S/C5H6ClN5O2S/c6-3-1(4(12)9-7)2(11-14-3)5(13)10-8/h7-8H2,(H,9,12)(H,10,13) |
| InChIKey | KKERYSWSFXKZNR-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,2-thiazole-3,4-dicarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2-thiazole-3,4-dicarbohydrazide?
The IUPAC name of 5-chloro-1,2-thiazole-3,4-dicarbohydrazide (CID 174710009) is 5-chloro-1,2-thiazole-3,4-dicarbohydrazide.
What is the SMILES notation for 5-chloro-1,2-thiazole-3,4-dicarbohydrazide?
The canonical SMILES for 5-chloro-1,2-thiazole-3,4-dicarbohydrazide is NNC(=O)c1nsc(Cl)c1C(=O)NN.
What is the InChIKey of 5-chloro-1,2-thiazole-3,4-dicarbohydrazide?
The InChIKey is KKERYSWSFXKZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClN5O2S/c6-3-1(4(12)9-7)2(11-14-3)5(13)10-8/h7-8H2,(H,9,12)(H,10,13).
What are the key properties of 5-chloro-1,2-thiazole-3,4-dicarbohydrazide?
5-chloro-1,2-thiazole-3,4-dicarbohydrazide has a molecular weight of 235.66 g/mol, XLogP of -1.00, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2-thiazole-3,4-dicarbohydrazide is sourced from PubChem (CID 174710009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).