C21H39O7P — CID 174710130
2-[(2,6-ditert-butyl-4-ethylphenoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphorous acid (PubChem CID 174710130) has the molecular formula C21H39O7P and a molecular weight of 434.51 g/mol. Its IUPAC name is 2-[(2,6-ditert-butyl-4-ethylphenoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphorous acid.
| Compound Name | 2-[(2,6-ditert-butyl-4-ethylphenoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphorous acid |
|---|---|
| PubChem CID | 174710130 |
| Molecular Formula | C21H39O7P |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[(2,6-ditert-butyl-4-ethylphenoxy)methyl]-2-(hydroxymethyl)propane-1,3-diol;phosphorous acid |
| SMILES | CCc1cc(C(C)(C)C)c(OCC(CO)(CO)CO)c(C(C)(C)C)c1.OP(O)O |
| InChI | InChI=1S/C21H36O4.H3O3P/c1-8-15-9-16(19(2,3)4)18(17(10-15)20(5,6)7)25-14-21(11-22,12-23)13-24;1-4(2)3/h9-10,22-24H,8,11-14H2,1-7H3;1-3H |
| InChIKey | RWDJSPTVHHTLEX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|