About lithium;1-bromo-3-phenylbenzene;hydride
lithium;1-bromo-3-phenylbenzene;hydride (PubChem CID 174710414) has the molecular formula C12H10BrLi
and a molecular weight of 241.06 g/mol. Its IUPAC name is lithium;1-bromo-3-phenylbenzene;hydride.
Molecular Properties
| Compound Name | lithium;1-bromo-3-phenylbenzene;hydride |
| PubChem CID | 174710414 |
| Molecular Formula | C12H10BrLi |
| Molecular Weight | 241.06 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | lithium;1-bromo-3-phenylbenzene;hydride |
| SMILES | Brc1cccc(-c2ccccc2)c1.[H-].[Li+] |
| InChI | InChI=1S/C12H9Br.Li.H/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;;/h1-9H;;/q;+1;-1 |
| InChIKey | QFYGEUSYFYHJQN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.06 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;1-bromo-3-phenylbenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1-bromo-3-phenylbenzene;hydride?
The IUPAC name of lithium;1-bromo-3-phenylbenzene;hydride (CID 174710414) is lithium;1-bromo-3-phenylbenzene;hydride.
What is the SMILES notation for lithium;1-bromo-3-phenylbenzene;hydride?
The canonical SMILES for lithium;1-bromo-3-phenylbenzene;hydride is Brc1cccc(-c2ccccc2)c1.[H-].[Li+].
What is the InChIKey of lithium;1-bromo-3-phenylbenzene;hydride?
The InChIKey is QFYGEUSYFYHJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br.Li.H/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;;/h1-9H;;/q;+1;-1.
What are the key properties of lithium;1-bromo-3-phenylbenzene;hydride?
lithium;1-bromo-3-phenylbenzene;hydride has a molecular weight of 241.06 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1-bromo-3-phenylbenzene;hydride is sourced from PubChem (CID 174710414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).