C38H37N3O2 — CID 174710725
2H-phthalazin-1-one;4-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]morpholine (PubChem CID 174710725) has the molecular formula C38H37N3O2 and a molecular weight of 567.73 g/mol. Its IUPAC name is 2H-phthalazin-1-one;4-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]morpholine.
| Compound Name | 2H-phthalazin-1-one;4-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 174710725 |
| Molecular Formula | C38H37N3O2 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 2H-phthalazin-1-one;4-[[4-(5,6,7,8-tetrahydrochrysen-4-ylmethyl)phenyl]methyl]morpholine |
| SMILES | C1=CC2=C(CC1)CCc1c2ccc2cccc(Cc3ccc(CN4CCOCC4)cc3)c12.O=c1[nH]ncc2ccccc12 |
| InChI | InChI=1S/C30H31NO.C8H6N2O/c1-2-7-27-24(4-1)12-15-29-28(27)14-13-25-5-3-6-26(30(25)29)20-22-8-10-23(11-9-22)21-31-16-18-32-19-17-31;11-8-7-4-2-1-3-6(7)5-9-10-8/h2-3,5-11,13-14H,1,4,12,15-21H2;1-5H,(H,10,11) |
| InChIKey | HBYGMGQVEWUBKM-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |