C21H23FN4O3S — CID 174711011
2-[3-[[4-(2-butoxy-4-fluorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinic acid (PubChem CID 174711011) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[3-[[4-(2-butoxy-4-fluorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinic acid.
| Compound Name | 2-[3-[[4-(2-butoxy-4-fluorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinic acid |
|---|---|
| PubChem CID | 174711011 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[3-[[4-(2-butoxy-4-fluorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]ethanesulfinic acid |
| SMILES | CCCCOc1cc(F)ccc1-c1ncnc(Nc2cccc(CCS(=O)O)c2)n1 |
| InChI | InChI=1S/C21H23FN4O3S/c1-2-3-10-29-19-13-16(22)7-8-18(19)20-23-14-24-21(26-20)25-17-6-4-5-15(12-17)9-11-30(27)28/h4-8,12-14H,2-3,9-11H2,1H3,(H,27,28)(H,23,24,25,26) |
| InChIKey | FMZWKVJULOLCQO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|