About diphenylphosphane;iron(3+);methanone
diphenylphosphane;iron(3+);methanone (PubChem CID 174711189) has the molecular formula C15H14FeO3P
and a molecular weight of 329.09 g/mol. Its IUPAC name is diphenylphosphane;iron(3+);methanone.
Molecular Properties
| Compound Name | diphenylphosphane;iron(3+);methanone |
| PubChem CID | 174711189 |
| Molecular Formula | C15H14FeO3P |
| Molecular Weight | 329.09 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | diphenylphosphane;iron(3+);methanone |
| SMILES | [CH-]=O.[CH-]=O.[CH-]=O.[Fe+3].c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.3CHO.Fe/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;3*1-2;/h1-10,13H;3*1H;/q;3*-1;+3 |
| InChIKey | GZQONYRDJGHPIS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.09 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;iron(3+);methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;iron(3+);methanone?
The IUPAC name of diphenylphosphane;iron(3+);methanone (CID 174711189) is diphenylphosphane;iron(3+);methanone.
What is the SMILES notation for diphenylphosphane;iron(3+);methanone?
The canonical SMILES for diphenylphosphane;iron(3+);methanone is [CH-]=O.[CH-]=O.[CH-]=O.[Fe+3].c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;iron(3+);methanone?
The InChIKey is GZQONYRDJGHPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.3CHO.Fe/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;3*1-2;/h1-10,13H;3*1H;/q;3*-1;+3.
What are the key properties of diphenylphosphane;iron(3+);methanone?
diphenylphosphane;iron(3+);methanone has a molecular weight of 329.09 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;iron(3+);methanone is sourced from PubChem (CID 174711189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).