C19H17F2N3O — CID 174711203
4-[4-[5-(3,4-difluorophenyl)pyrazol-1-yl]phenyl]morpholine (PubChem CID 174711203) has the molecular formula C19H17F2N3O and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-[4-[5-(3,4-difluorophenyl)pyrazol-1-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(3,4-difluorophenyl)pyrazol-1-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 174711203 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[4-[5-(3,4-difluorophenyl)pyrazol-1-yl]phenyl]morpholine |
| SMILES | Fc1ccc(-c2ccnn2-c2ccc(N3CCOCC3)cc2)cc1F |
| InChI | InChI=1S/C19H17F2N3O/c20-17-6-1-14(13-18(17)21)19-7-8-22-24(19)16-4-2-15(3-5-16)23-9-11-25-12-10-23/h1-8,13H,9-12H2 |
| InChIKey | JODYGNGNJPEEOQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|