C22H32O6 — CID 174711302
3-O-ethyl 2-O-hexyl 7,7-dimethyl-1-prop-2-enoyloxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 174711302) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 3-O-ethyl 2-O-hexyl 7,7-dimethyl-1-prop-2-enoyloxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-hexyl 7,7-dimethyl-1-prop-2-enoyloxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 174711302 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-O-ethyl 2-O-hexyl 7,7-dimethyl-1-prop-2-enoyloxybicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | C=CC(=O)OC12C=CC(C(C(=O)OCC)C1C(=O)OCCCCCC)C2(C)C |
| InChI | InChI=1S/C22H32O6/c1-6-9-10-11-14-27-20(25)18-17(19(24)26-8-3)15-12-13-22(18,21(15,4)5)28-16(23)7-2/h7,12-13,15,17-18H,2,6,8-11,14H2,1,3-5H3 |
| InChIKey | RZPBMQZZEUDXJE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|