About 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium
5-cyclopentylcyclopenta-1,3-diene;diiodotitanium (PubChem CID 174711329) has the molecular formula C10H14I2Ti
and a molecular weight of 435.90 g/mol. Its IUPAC name is 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium.
Molecular Properties
| Compound Name | 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium |
| PubChem CID | 174711329 |
| Molecular Formula | C10H14I2Ti |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.87 |
| IUPAC Name | 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium |
| SMILES | C1=CC(C2CCCC2)C=C1.I[Ti]I |
| InChI | InChI=1S/C10H14.2HI.Ti/c1-2-6-9(5-1)10-7-3-4-8-10;;;/h1-2,5-6,9-10H,3-4,7-8H2;2*1H;/q;;;+2/p-2 |
| InChIKey | VSWMZWKVLHXXEQ-UHFFFAOYSA-L |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium?
The IUPAC name of 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium (CID 174711329) is 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium.
What is the SMILES notation for 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium?
The canonical SMILES for 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium is C1=CC(C2CCCC2)C=C1.I[Ti]I.
What is the InChIKey of 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium?
The InChIKey is VSWMZWKVLHXXEQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H14.2HI.Ti/c1-2-6-9(5-1)10-7-3-4-8-10;;;/h1-2,5-6,9-10H,3-4,7-8H2;2*1H;/q;;;+2/p-2.
What are the key properties of 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium?
5-cyclopentylcyclopenta-1,3-diene;diiodotitanium has a molecular weight of 435.90 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentylcyclopenta-1,3-diene;diiodotitanium is sourced from PubChem (CID 174711329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).