About 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride
1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride (PubChem CID 174711446) has the molecular formula C12H13Cl2Ti
and a molecular weight of 276.01 g/mol. Its IUPAC name is 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride.
Molecular Properties
| Compound Name | 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride |
| PubChem CID | 174711446 |
| Molecular Formula | C12H13Cl2Ti |
| Molecular Weight | 276.01 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride |
| SMILES | CCCC1[C-]=Cc2ccccc21.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C12H13.2ClH.Ti/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;;;/h3-4,6-7,9-10H,2,5H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | VYIHOEBWOHVZLB-UHFFFAOYSA-L |
| XLogP | -2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.01 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride?
The IUPAC name of 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride (CID 174711446) is 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride.
What is the SMILES notation for 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride?
The canonical SMILES for 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride is CCCC1[C-]=Cc2ccccc21.[Cl-].[Cl-].[Ti+3].
What is the InChIKey of 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride?
The InChIKey is VYIHOEBWOHVZLB-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H13.2ClH.Ti/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;;;/h3-4,6-7,9-10H,2,5H2,1H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride?
1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride has a molecular weight of 276.01 g/mol, XLogP of -2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-1,2-dihydroinden-2-ide;titanium(3+);dichloride is sourced from PubChem (CID 174711446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).