About azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine
azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine (PubChem CID 174711718) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine.
Molecular Properties
| Compound Name | azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine |
| PubChem CID | 174711718 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine |
| SMILES | N.c1cc2cc(c1)C2.c1ccncc1 |
| InChI | InChI=1S/C7H6.C5H5N.H3N/c1-2-6-4-7(3-1)5-6;1-2-4-6-5-3-1;/h1-4H,5H2;1-5H;1H3 |
| InChIKey | LGTFDGRQZICXLF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine?
The IUPAC name of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine (CID 174711718) is azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine.
What is the SMILES notation for azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine?
The canonical SMILES for azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine is N.c1cc2cc(c1)C2.c1ccncc1.
What is the InChIKey of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine?
The InChIKey is LGTFDGRQZICXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6.C5H5N.H3N/c1-2-6-4-7(3-1)5-6;1-2-4-6-5-3-1;/h1-4H,5H2;1-5H;1H3.
What are the key properties of azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine?
azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine has a molecular weight of 186.26 g/mol, XLogP of 2.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bicyclo[3.1.1]hepta-1(6),2,4-triene;pyridine is sourced from PubChem (CID 174711718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).