About 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol
3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol (PubChem CID 174712121) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol |
| PubChem CID | 174712121 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol |
| SMILES | NCC(NCCCO)(C1CCC1)C1CCC1 |
| InChI | InChI=1S/C13H26N2O/c14-10-13(11-4-1-5-11,12-6-2-7-12)15-8-3-9-16/h11-12,15-16H,1-10,14H2 |
| InChIKey | QIYPULPYLOOVCZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol?
The IUPAC name of 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol (CID 174712121) is 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol.
What is the SMILES notation for 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol?
The canonical SMILES for 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol is NCC(NCCCO)(C1CCC1)C1CCC1.
What is the InChIKey of 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol?
The InChIKey is QIYPULPYLOOVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c14-10-13(11-4-1-5-11,12-6-2-7-12)15-8-3-9-16/h11-12,15-16H,1-10,14H2.
What are the key properties of 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol?
3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol has a molecular weight of 226.36 g/mol, XLogP of 1.26, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-amino-1,1-di(cyclobutyl)ethyl]amino]propan-1-ol is sourced from PubChem (CID 174712121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).