About 6-methylquinolin-2-amine;morpholine
6-methylquinolin-2-amine;morpholine (PubChem CID 174712128) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-methylquinolin-2-amine;morpholine.
Molecular Properties
| Compound Name | 6-methylquinolin-2-amine;morpholine |
| PubChem CID | 174712128 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 6-methylquinolin-2-amine;morpholine |
| SMILES | C1COCCN1.Cc1ccc2nc(N)ccc2c1 |
| InChI | InChI=1S/C10H10N2.C4H9NO/c1-7-2-4-9-8(6-7)3-5-10(11)12-9;1-3-6-4-2-5-1/h2-6H,1H3,(H2,11,12);5H,1-4H2 |
| InChIKey | IEBCPZMGFXTBHA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methylquinolin-2-amine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylquinolin-2-amine;morpholine?
The IUPAC name of 6-methylquinolin-2-amine;morpholine (CID 174712128) is 6-methylquinolin-2-amine;morpholine.
What is the SMILES notation for 6-methylquinolin-2-amine;morpholine?
The canonical SMILES for 6-methylquinolin-2-amine;morpholine is C1COCCN1.Cc1ccc2nc(N)ccc2c1.
What is the InChIKey of 6-methylquinolin-2-amine;morpholine?
The InChIKey is IEBCPZMGFXTBHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C4H9NO/c1-7-2-4-9-8(6-7)3-5-10(11)12-9;1-3-6-4-2-5-1/h2-6H,1H3,(H2,11,12);5H,1-4H2.
What are the key properties of 6-methylquinolin-2-amine;morpholine?
6-methylquinolin-2-amine;morpholine has a molecular weight of 245.33 g/mol, XLogP of 1.73, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylquinolin-2-amine;morpholine is sourced from PubChem (CID 174712128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).