About [4-(dimethylamino)phenyl]methyl-λ2-stannane
[4-(dimethylamino)phenyl]methyl-λ2-stannane (PubChem CID 174712145) has the molecular formula C9H13NSn
and a molecular weight of 253.92 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]methyl-λ2-stannane.
Molecular Properties
| Compound Name | [4-(dimethylamino)phenyl]methyl-λ2-stannane |
| PubChem CID | 174712145 |
| Molecular Formula | C9H13NSn |
| Molecular Weight | 253.92 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | [4-(dimethylamino)phenyl]methyl-λ2-stannane |
| SMILES | CN(C)c1ccc(C[SnH])cc1 |
| InChI | InChI=1S/C9H12N.Sn.H/c1-8-4-6-9(7-5-8)10(2)3;;/h4-7H,1H2,2-3H3;; |
| InChIKey | NOTQVBSISSIHHP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.92 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze [4-(dimethylamino)phenyl]methyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(dimethylamino)phenyl]methyl-λ2-stannane?
The IUPAC name of [4-(dimethylamino)phenyl]methyl-λ2-stannane (CID 174712145) is [4-(dimethylamino)phenyl]methyl-λ2-stannane.
What is the SMILES notation for [4-(dimethylamino)phenyl]methyl-λ2-stannane?
The canonical SMILES for [4-(dimethylamino)phenyl]methyl-λ2-stannane is CN(C)c1ccc(C[SnH])cc1.
What is the InChIKey of [4-(dimethylamino)phenyl]methyl-λ2-stannane?
The InChIKey is NOTQVBSISSIHHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.Sn.H/c1-8-4-6-9(7-5-8)10(2)3;;/h4-7H,1H2,2-3H3;;.
What are the key properties of [4-(dimethylamino)phenyl]methyl-λ2-stannane?
[4-(dimethylamino)phenyl]methyl-λ2-stannane has a molecular weight of 253.92 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(dimethylamino)phenyl]methyl-λ2-stannane is sourced from PubChem (CID 174712145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).