About 1-bromo-9H-xanthene;9H-xanthene
1-bromo-9H-xanthene;9H-xanthene (PubChem CID 174712211) has the molecular formula C26H19BrO2
and a molecular weight of 443.34 g/mol. Its IUPAC name is 1-bromo-9H-xanthene;9H-xanthene.
Molecular Properties
| Compound Name | 1-bromo-9H-xanthene;9H-xanthene |
| PubChem CID | 174712211 |
| Molecular Formula | C26H19BrO2 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-bromo-9H-xanthene;9H-xanthene |
| SMILES | Brc1cccc2c1Cc1ccccc1O2.c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C13H9BrO.C13H10O/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-7H,8H2;1-8H,9H2 |
| InChIKey | ZIMFTQGHJRLTLG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-9H-xanthene;9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9H-xanthene;9H-xanthene?
The IUPAC name of 1-bromo-9H-xanthene;9H-xanthene (CID 174712211) is 1-bromo-9H-xanthene;9H-xanthene.
What is the SMILES notation for 1-bromo-9H-xanthene;9H-xanthene?
The canonical SMILES for 1-bromo-9H-xanthene;9H-xanthene is Brc1cccc2c1Cc1ccccc1O2.c1ccc2c(c1)Cc1ccccc1O2.
What is the InChIKey of 1-bromo-9H-xanthene;9H-xanthene?
The InChIKey is ZIMFTQGHJRLTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO.C13H10O/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-7H,8H2;1-8H,9H2.
What are the key properties of 1-bromo-9H-xanthene;9H-xanthene?
1-bromo-9H-xanthene;9H-xanthene has a molecular weight of 443.34 g/mol, XLogP of 7.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9H-xanthene;9H-xanthene is sourced from PubChem (CID 174712211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).