About (5-ethynylthiophen-2-yl) acetate
(5-ethynylthiophen-2-yl) acetate (PubChem CID 174712384) has the molecular formula C8H6O2S
and a molecular weight of 166.20 g/mol. Its IUPAC name is (5-ethynylthiophen-2-yl) acetate.
Molecular Properties
| Compound Name | (5-ethynylthiophen-2-yl) acetate |
| PubChem CID | 174712384 |
| Molecular Formula | C8H6O2S |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | (5-ethynylthiophen-2-yl) acetate |
| SMILES | C#Cc1ccc(OC(C)=O)s1 |
| InChI | InChI=1S/C8H6O2S/c1-3-7-4-5-8(11-7)10-6(2)9/h1,4-5H,2H3 |
| InChIKey | HGIQLMWBFSMERV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-ethynylthiophen-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethynylthiophen-2-yl) acetate?
The IUPAC name of (5-ethynylthiophen-2-yl) acetate (CID 174712384) is (5-ethynylthiophen-2-yl) acetate.
What is the SMILES notation for (5-ethynylthiophen-2-yl) acetate?
The canonical SMILES for (5-ethynylthiophen-2-yl) acetate is C#Cc1ccc(OC(C)=O)s1.
What is the InChIKey of (5-ethynylthiophen-2-yl) acetate?
The InChIKey is HGIQLMWBFSMERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2S/c1-3-7-4-5-8(11-7)10-6(2)9/h1,4-5H,2H3.
What are the key properties of (5-ethynylthiophen-2-yl) acetate?
(5-ethynylthiophen-2-yl) acetate has a molecular weight of 166.20 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethynylthiophen-2-yl) acetate is sourced from PubChem (CID 174712384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).