About 4-bromobut-2-enyl hydrogen carbonate
4-bromobut-2-enyl hydrogen carbonate (PubChem CID 174712410) has the molecular formula C5H7BrO3
and a molecular weight of 195.01 g/mol. Its IUPAC name is 4-bromobut-2-enyl hydrogen carbonate.
Molecular Properties
| Compound Name | 4-bromobut-2-enyl hydrogen carbonate |
| PubChem CID | 174712410 |
| Molecular Formula | C5H7BrO3 |
| Molecular Weight | 195.01 g/mol |
| Exact Mass | 193.96 |
| IUPAC Name | 4-bromobut-2-enyl hydrogen carbonate |
| SMILES | O=C(O)OCC=CCBr |
| InChI | InChI=1S/C5H7BrO3/c6-3-1-2-4-9-5(7)8/h1-2H,3-4H2,(H,7,8) |
| InChIKey | ZEFSIFYWUBJWFA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.01 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobut-2-enyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobut-2-enyl hydrogen carbonate?
The IUPAC name of 4-bromobut-2-enyl hydrogen carbonate (CID 174712410) is 4-bromobut-2-enyl hydrogen carbonate.
What is the SMILES notation for 4-bromobut-2-enyl hydrogen carbonate?
The canonical SMILES for 4-bromobut-2-enyl hydrogen carbonate is O=C(O)OCC=CCBr.
What is the InChIKey of 4-bromobut-2-enyl hydrogen carbonate?
The InChIKey is ZEFSIFYWUBJWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrO3/c6-3-1-2-4-9-5(7)8/h1-2H,3-4H2,(H,7,8).
What are the key properties of 4-bromobut-2-enyl hydrogen carbonate?
4-bromobut-2-enyl hydrogen carbonate has a molecular weight of 195.01 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobut-2-enyl hydrogen carbonate is sourced from PubChem (CID 174712410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).