C19H22FNO2 — CID 174712514
1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]butan-2-imine (PubChem CID 174712514) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]butan-2-imine.
| Compound Name | 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]butan-2-imine |
|---|---|
| PubChem CID | 174712514 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[4-(4-ethyl-2-methoxyphenoxy)-3-fluorophenyl]butan-2-imine |
| SMILES | [H]/N=C(\CC)Cc1ccc(Oc2ccc(CC)cc2OC)c(F)c1 |
| InChI | InChI=1S/C19H22FNO2/c1-4-13-6-9-18(19(12-13)22-3)23-17-8-7-14(11-16(17)20)10-15(21)5-2/h6-9,11-12,21H,4-5,10H2,1-3H3/b21-15+ |
| InChIKey | MATOEGAPNDDGBH-RCCKNPSSSA-N |
| XLogP | 5.16 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|