1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid

C16H23NO5 — CID 174713204

IUPAC1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid
SMILESCCCCN1c2c(cc(OC)c(OC)c2OC)CC1C(=O)O
InChIInChI=1S/C16H23NO5/c1-5-6-7-17-11(16(18)19)8-10-9-12(20-2)14(21-3)15(22-4)13(10)17/h9,11H,5-8H2,1-4H3,(H,18,19)
InChIKeyNIGADAKQZZFWLU-UHFFFAOYSA-N
MW309.36 g/mol
LogP2.33
Rot. Bonds7

About 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid

1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid (PubChem CID 174713204) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid.

Molecular Properties

Compound Name1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid
PubChem CID174713204
Molecular FormulaC16H23NO5
Molecular Weight309.36 g/mol
Exact Mass309.16
IUPAC Name1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid
SMILESCCCCN1c2c(cc(OC)c(OC)c2OC)CC1C(=O)O
InChIInChI=1S/C16H23NO5/c1-5-6-7-17-11(16(18)19)8-10-9-12(20-2)14(21-3)15(22-4)13(10)17/h9,11H,5-8H2,1-4H3,(H,18,19)
InChIKeyNIGADAKQZZFWLU-UHFFFAOYSA-N
XLogP2.33
TPSA68.23 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.36
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}

Analyze 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid?
The IUPAC name of 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid (CID 174713204) is 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid.
What is the SMILES notation for 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid?
The canonical SMILES for 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid is CCCCN1c2c(cc(OC)c(OC)c2OC)CC1C(=O)O.
What is the InChIKey of 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid?
The InChIKey is NIGADAKQZZFWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO5/c1-5-6-7-17-11(16(18)19)8-10-9-12(20-2)14(21-3)15(22-4)13(10)17/h9,11H,5-8H2,1-4H3,(H,18,19).
What are the key properties of 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid?
1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid has a molecular weight of 309.36 g/mol, XLogP of 2.33, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid is sourced from PubChem (CID 174713204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).