C16H23NO5 — CID 174713204
1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid (PubChem CID 174713204) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 174713204 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-butyl-5,6,7-trimethoxy-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CCCCN1c2c(cc(OC)c(OC)c2OC)CC1C(=O)O |
| InChI | InChI=1S/C16H23NO5/c1-5-6-7-17-11(16(18)19)8-10-9-12(20-2)14(21-3)15(22-4)13(10)17/h9,11H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | NIGADAKQZZFWLU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|