About 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene
1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene (PubChem CID 174713476) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene.
Molecular Properties
| Compound Name | 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene |
| PubChem CID | 174713476 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene |
| SMILES | CCCC(CO)C(=O)OC(C)COC.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H20O4.C8H10/c1-4-5-9(6-11)10(12)14-8(2)7-13-3;1-7-3-5-8(2)6-4-7/h8-9,11H,4-7H2,1-3H3;3-6H,1-2H3 |
| InChIKey | LYECLGDDRYWYGK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene?
The IUPAC name of 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene (CID 174713476) is 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene.
What is the SMILES notation for 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene?
The canonical SMILES for 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene is CCCC(CO)C(=O)OC(C)COC.Cc1ccc(C)cc1.
What is the InChIKey of 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene?
The InChIKey is LYECLGDDRYWYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4.C8H10/c1-4-5-9(6-11)10(12)14-8(2)7-13-3;1-7-3-5-8(2)6-4-7/h8-9,11H,4-7H2,1-3H3;3-6H,1-2H3.
What are the key properties of 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene?
1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene has a molecular weight of 310.43 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 2-(hydroxymethyl)pentanoate;1,4-xylene is sourced from PubChem (CID 174713476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).