About diethyl 2-propylbutanedioate;N-ethylethanamine
diethyl 2-propylbutanedioate;N-ethylethanamine (PubChem CID 174714247) has the molecular formula C15H31NO4
and a molecular weight of 289.42 g/mol. Its IUPAC name is diethyl 2-propylbutanedioate;N-ethylethanamine.
Molecular Properties
| Compound Name | diethyl 2-propylbutanedioate;N-ethylethanamine |
| PubChem CID | 174714247 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | diethyl 2-propylbutanedioate;N-ethylethanamine |
| SMILES | CCCC(CC(=O)OCC)C(=O)OCC.CCNCC |
| InChI | InChI=1S/C11H20O4.C4H11N/c1-4-7-9(11(13)15-6-3)8-10(12)14-5-2;1-3-5-4-2/h9H,4-8H2,1-3H3;5H,3-4H2,1-2H3 |
| InChIKey | SWJOGLAFKWZMCH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 2-propylbutanedioate;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-propylbutanedioate;N-ethylethanamine?
The IUPAC name of diethyl 2-propylbutanedioate;N-ethylethanamine (CID 174714247) is diethyl 2-propylbutanedioate;N-ethylethanamine.
What is the SMILES notation for diethyl 2-propylbutanedioate;N-ethylethanamine?
The canonical SMILES for diethyl 2-propylbutanedioate;N-ethylethanamine is CCCC(CC(=O)OCC)C(=O)OCC.CCNCC.
What is the InChIKey of diethyl 2-propylbutanedioate;N-ethylethanamine?
The InChIKey is SWJOGLAFKWZMCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4.C4H11N/c1-4-7-9(11(13)15-6-3)8-10(12)14-5-2;1-3-5-4-2/h9H,4-8H2,1-3H3;5H,3-4H2,1-2H3.
What are the key properties of diethyl 2-propylbutanedioate;N-ethylethanamine?
diethyl 2-propylbutanedioate;N-ethylethanamine has a molecular weight of 289.42 g/mol, XLogP of 2.53, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-propylbutanedioate;N-ethylethanamine is sourced from PubChem (CID 174714247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).