C16H26O4 — CID 174714646
ethyl 2-(2-ethyl-6-hydroxy-1-oxo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)acetate (PubChem CID 174714646) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is ethyl 2-(2-ethyl-6-hydroxy-1-oxo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)acetate.
| Compound Name | ethyl 2-(2-ethyl-6-hydroxy-1-oxo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)acetate |
|---|---|
| PubChem CID | 174714646 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | ethyl 2-(2-ethyl-6-hydroxy-1-oxo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl)acetate |
| SMILES | CCOC(=O)CC1(CC)CCC2CC(O)CCC2C1=O |
| InChI | InChI=1S/C16H26O4/c1-3-16(10-14(18)20-4-2)8-7-11-9-12(17)5-6-13(11)15(16)19/h11-13,17H,3-10H2,1-2H3 |
| InChIKey | GBDYSQMQQLPPCP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |