About chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole
chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole (PubChem CID 174714717) has the molecular formula C20H23ClN2OS
and a molecular weight of 374.94 g/mol. Its IUPAC name is chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole |
| PubChem CID | 174714717 |
| Molecular Formula | C20H23ClN2OS |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole |
| SMILES | CCOCc1sc(-c2ccnc(CC)c2)nc1C.Clc1ccccc1 |
| InChI | InChI=1S/C14H18N2OS.C6H5Cl/c1-4-12-8-11(6-7-15-12)14-16-10(3)13(18-14)9-17-5-2;7-6-4-2-1-3-5-6/h6-8H,4-5,9H2,1-3H3;1-5H |
| InChIKey | AHAXHFTVBMCSJK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole?
The IUPAC name of chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole (CID 174714717) is chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole.
What is the SMILES notation for chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole?
The canonical SMILES for chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole is CCOCc1sc(-c2ccnc(CC)c2)nc1C.Clc1ccccc1.
What is the InChIKey of chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole?
The InChIKey is AHAXHFTVBMCSJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS.C6H5Cl/c1-4-12-8-11(6-7-15-12)14-16-10(3)13(18-14)9-17-5-2;7-6-4-2-1-3-5-6/h6-8H,4-5,9H2,1-3H3;1-5H.
What are the key properties of chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole?
chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole has a molecular weight of 374.94 g/mol, XLogP of 5.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;5-(ethoxymethyl)-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazole is sourced from PubChem (CID 174714717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).