About 1-carbazol-9-ylethanone;diaziridin-3-one
1-carbazol-9-ylethanone;diaziridin-3-one (PubChem CID 174714920) has the molecular formula C15H13N3O2
and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-carbazol-9-ylethanone;diaziridin-3-one.
Molecular Properties
| Compound Name | 1-carbazol-9-ylethanone;diaziridin-3-one |
| PubChem CID | 174714920 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-carbazol-9-ylethanone;diaziridin-3-one |
| SMILES | CC(=O)n1c2ccccc2c2ccccc21.O=C1NN1 |
| InChI | InChI=1S/C14H11NO.CH2N2O/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15;4-1-2-3-1/h2-9H,1H3;(H2,2,3,4) |
| InChIKey | ZDMOXEQLGDKKBW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-carbazol-9-ylethanone;diaziridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbazol-9-ylethanone;diaziridin-3-one?
The IUPAC name of 1-carbazol-9-ylethanone;diaziridin-3-one (CID 174714920) is 1-carbazol-9-ylethanone;diaziridin-3-one.
What is the SMILES notation for 1-carbazol-9-ylethanone;diaziridin-3-one?
The canonical SMILES for 1-carbazol-9-ylethanone;diaziridin-3-one is CC(=O)n1c2ccccc2c2ccccc21.O=C1NN1.
What is the InChIKey of 1-carbazol-9-ylethanone;diaziridin-3-one?
The InChIKey is ZDMOXEQLGDKKBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO.CH2N2O/c1-10(16)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15;4-1-2-3-1/h2-9H,1H3;(H2,2,3,4).
What are the key properties of 1-carbazol-9-ylethanone;diaziridin-3-one?
1-carbazol-9-ylethanone;diaziridin-3-one has a molecular weight of 267.29 g/mol, XLogP of 2.67, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbazol-9-ylethanone;diaziridin-3-one is sourced from PubChem (CID 174714920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).