C18H22N2O — CID 174715110
azane;1,2,3,4-tetrahydrochrysen-1-amine;hydrate (PubChem CID 174715110) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is azane;1,2,3,4-tetrahydrochrysen-1-amine;hydrate.
| Compound Name | azane;1,2,3,4-tetrahydrochrysen-1-amine;hydrate |
|---|---|
| PubChem CID | 174715110 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | azane;1,2,3,4-tetrahydrochrysen-1-amine;hydrate |
| SMILES | N.NC1CCCc2c1ccc1c2ccc2ccccc21.O |
| InChI | InChI=1S/C18H17N.H3N.H2O/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;;/h1-2,4-5,8-11,18H,3,6-7,19H2;1H3;1H2 |
| InChIKey | WYGUPCZRCYTKAF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|