About 1H-cyclopenta[8]annulene;2H-triazepine
1H-cyclopenta[8]annulene;2H-triazepine (PubChem CID 174715149) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is 1H-cyclopenta[8]annulene;2H-triazepine.
Molecular Properties
| Compound Name | 1H-cyclopenta[8]annulene;2H-triazepine |
| PubChem CID | 174715149 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1H-cyclopenta[8]annulene;2H-triazepine |
| SMILES | C1=CC=CC2=C(C=C1)C=CC2.C1=CC=NNN=C1 |
| InChI | InChI=1S/C11H10.C4H5N3/c1-2-4-7-11-9-5-8-10(11)6-3-1;1-2-4-6-7-5-3-1/h1-8H,9H2;1-4,7H |
| InChIKey | MKQUVJHGYJSSTE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-cyclopenta[8]annulene;2H-triazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclopenta[8]annulene;2H-triazepine?
The IUPAC name of 1H-cyclopenta[8]annulene;2H-triazepine (CID 174715149) is 1H-cyclopenta[8]annulene;2H-triazepine.
What is the SMILES notation for 1H-cyclopenta[8]annulene;2H-triazepine?
The canonical SMILES for 1H-cyclopenta[8]annulene;2H-triazepine is C1=CC=CC2=C(C=C1)C=CC2.C1=CC=NNN=C1.
What is the InChIKey of 1H-cyclopenta[8]annulene;2H-triazepine?
The InChIKey is MKQUVJHGYJSSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C4H5N3/c1-2-4-7-11-9-5-8-10(11)6-3-1;1-2-4-6-7-5-3-1/h1-8H,9H2;1-4,7H.
What are the key properties of 1H-cyclopenta[8]annulene;2H-triazepine?
1H-cyclopenta[8]annulene;2H-triazepine has a molecular weight of 237.31 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclopenta[8]annulene;2H-triazepine is sourced from PubChem (CID 174715149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).