C20H31N3 — CID 174715815
1-N,1-N',3-N-trimethyl-2-[(E)-2-(3-propylphenyl)ethenyl]cyclohex-2-ene-1,1,3-triamine (PubChem CID 174715815) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-N,1-N',3-N-trimethyl-2-[(E)-2-(3-propylphenyl)ethenyl]cyclohex-2-ene-1,1,3-triamine.
| Compound Name | 1-N,1-N',3-N-trimethyl-2-[(E)-2-(3-propylphenyl)ethenyl]cyclohex-2-ene-1,1,3-triamine |
|---|---|
| PubChem CID | 174715815 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 1-N,1-N',3-N-trimethyl-2-[(E)-2-(3-propylphenyl)ethenyl]cyclohex-2-ene-1,1,3-triamine |
| SMILES | CCCc1cccc(/C=C/C2=C(NC)CCCC2(NC)NC)c1 |
| InChI | InChI=1S/C20H31N3/c1-5-8-16-9-6-10-17(15-16)12-13-18-19(21-2)11-7-14-20(18,22-3)23-4/h6,9-10,12-13,15,21-23H,5,7-8,11,14H2,1-4H3/b13-12+ |
| InChIKey | TVSKPXWQSJPKGN-OUKQBFOZSA-N |
| XLogP | 3.44 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|