About 4-amino-2,3-dihydropyridine-2-carboxylic acid
4-amino-2,3-dihydropyridine-2-carboxylic acid (PubChem CID 174716021) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 4-amino-2,3-dihydropyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-2,3-dihydropyridine-2-carboxylic acid |
| PubChem CID | 174716021 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 4-amino-2,3-dihydropyridine-2-carboxylic acid |
| SMILES | NC1=CC=NC(C(=O)O)C1 |
| InChI | InChI=1S/C6H8N2O2/c7-4-1-2-8-5(3-4)6(9)10/h1-2,5H,3,7H2,(H,9,10) |
| InChIKey | YNEVZTZKLFHISI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-2,3-dihydropyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dihydropyridine-2-carboxylic acid?
The IUPAC name of 4-amino-2,3-dihydropyridine-2-carboxylic acid (CID 174716021) is 4-amino-2,3-dihydropyridine-2-carboxylic acid.
What is the SMILES notation for 4-amino-2,3-dihydropyridine-2-carboxylic acid?
The canonical SMILES for 4-amino-2,3-dihydropyridine-2-carboxylic acid is NC1=CC=NC(C(=O)O)C1.
What is the InChIKey of 4-amino-2,3-dihydropyridine-2-carboxylic acid?
The InChIKey is YNEVZTZKLFHISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c7-4-1-2-8-5(3-4)6(9)10/h1-2,5H,3,7H2,(H,9,10).
What are the key properties of 4-amino-2,3-dihydropyridine-2-carboxylic acid?
4-amino-2,3-dihydropyridine-2-carboxylic acid has a molecular weight of 140.14 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dihydropyridine-2-carboxylic acid is sourced from PubChem (CID 174716021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).