About 3-fluoro-2,4-di(propan-2-yl)phenol
3-fluoro-2,4-di(propan-2-yl)phenol (PubChem CID 174716434) has the molecular formula C12H17FO
and a molecular weight of 196.26 g/mol. Its IUPAC name is 3-fluoro-2,4-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 3-fluoro-2,4-di(propan-2-yl)phenol |
| PubChem CID | 174716434 |
| Molecular Formula | C12H17FO |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3-fluoro-2,4-di(propan-2-yl)phenol |
| SMILES | CC(C)c1ccc(O)c(C(C)C)c1F |
| InChI | InChI=1S/C12H17FO/c1-7(2)9-5-6-10(14)11(8(3)4)12(9)13/h5-8,14H,1-4H3 |
| InChIKey | TZXHZQWEFGSFJX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2,4-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,4-di(propan-2-yl)phenol?
The IUPAC name of 3-fluoro-2,4-di(propan-2-yl)phenol (CID 174716434) is 3-fluoro-2,4-di(propan-2-yl)phenol.
What is the SMILES notation for 3-fluoro-2,4-di(propan-2-yl)phenol?
The canonical SMILES for 3-fluoro-2,4-di(propan-2-yl)phenol is CC(C)c1ccc(O)c(C(C)C)c1F.
What is the InChIKey of 3-fluoro-2,4-di(propan-2-yl)phenol?
The InChIKey is TZXHZQWEFGSFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FO/c1-7(2)9-5-6-10(14)11(8(3)4)12(9)13/h5-8,14H,1-4H3.
What are the key properties of 3-fluoro-2,4-di(propan-2-yl)phenol?
3-fluoro-2,4-di(propan-2-yl)phenol has a molecular weight of 196.26 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,4-di(propan-2-yl)phenol is sourced from PubChem (CID 174716434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).