About sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane
sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane (PubChem CID 174716663) has the molecular formula C3H6F3NNaO2S-
and a molecular weight of 200.14 g/mol. Its IUPAC name is sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane.
Molecular Properties
| Compound Name | sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane |
| PubChem CID | 174716663 |
| Molecular Formula | C3H6F3NNaO2S- |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane |
| SMILES | O=S([O-])NCCC(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C3H6F3NO2S.Na.H/c4-3(5,6)1-2-7-10(8)9;;/h7H,1-2H2,(H,8,9);;/q;+1;-1/p-1 |
| InChIKey | VAELKYBENUBHLF-UHFFFAOYSA-M |
| XLogP | -2.56 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane?
The IUPAC name of sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane (CID 174716663) is sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane.
What is the SMILES notation for sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane?
The canonical SMILES for sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane is O=S([O-])NCCC(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane?
The InChIKey is VAELKYBENUBHLF-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6F3NO2S.Na.H/c4-3(5,6)1-2-7-10(8)9;;/h7H,1-2H2,(H,8,9);;/q;+1;-1/p-1.
What are the key properties of sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane?
sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane has a molecular weight of 200.14 g/mol, XLogP of -2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;1,1,1-trifluoro-3-(sulfinatoamino)propane is sourced from PubChem (CID 174716663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).