C45H58N4O5 — CID 174716687
2,4-bis[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-1,5-bis(2-methylphenoxy)pentan-3-one (PubChem CID 174716687) has the molecular formula C45H58N4O5 and a molecular weight of 734.98 g/mol. Its IUPAC name is 2,4-bis[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-1,5-bis(2-methylphenoxy)pentan-3-one.
| Compound Name | 2,4-bis[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-1,5-bis(2-methylphenoxy)pentan-3-one |
|---|---|
| PubChem CID | 174716687 |
| Molecular Formula | C45H58N4O5 |
| Molecular Weight | 734.98 g/mol |
| Exact Mass | 734.44 |
| IUPAC Name | 2,4-bis[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-1,5-bis(2-methylphenoxy)pentan-3-one |
| SMILES | CCOc1ccc(CN2CCN(C(COc3ccccc3C)C(=O)C(COc3ccccc3C)N3CCN(Cc4ccc(OCC)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C45H58N4O5/c1-5-51-39-19-15-37(16-20-39)31-46-23-27-48(28-24-46)41(33-53-43-13-9-7-11-35(43)3)45(50)42(34-54-44-14-10-8-12-36(44)4)49-29-25-47(26-30-49)32-38-17-21-40(22-18-38)52-6-2/h7-22,41-42H,5-6,23-34H2,1-4H3 |
| InChIKey | XYQJONSXCDQIDW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 66.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.98 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |