About 5-bromopyridin-3-ol;morpholine-4-sulfonic acid
5-bromopyridin-3-ol;morpholine-4-sulfonic acid (PubChem CID 174717058) has the molecular formula C9H13BrN2O5S
and a molecular weight of 341.18 g/mol. Its IUPAC name is 5-bromopyridin-3-ol;morpholine-4-sulfonic acid.
Molecular Properties
| Compound Name | 5-bromopyridin-3-ol;morpholine-4-sulfonic acid |
| PubChem CID | 174717058 |
| Molecular Formula | C9H13BrN2O5S |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 5-bromopyridin-3-ol;morpholine-4-sulfonic acid |
| SMILES | O=S(=O)(O)N1CCOCC1.Oc1cncc(Br)c1 |
| InChI | InChI=1S/C5H4BrNO.C4H9NO4S/c6-4-1-5(8)3-7-2-4;6-10(7,8)5-1-3-9-4-2-5/h1-3,8H;1-4H2,(H,6,7,8) |
| InChIKey | VBYZUHROJZCGNE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopyridin-3-ol;morpholine-4-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopyridin-3-ol;morpholine-4-sulfonic acid?
The IUPAC name of 5-bromopyridin-3-ol;morpholine-4-sulfonic acid (CID 174717058) is 5-bromopyridin-3-ol;morpholine-4-sulfonic acid.
What is the SMILES notation for 5-bromopyridin-3-ol;morpholine-4-sulfonic acid?
The canonical SMILES for 5-bromopyridin-3-ol;morpholine-4-sulfonic acid is O=S(=O)(O)N1CCOCC1.Oc1cncc(Br)c1.
What is the InChIKey of 5-bromopyridin-3-ol;morpholine-4-sulfonic acid?
The InChIKey is VBYZUHROJZCGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNO.C4H9NO4S/c6-4-1-5(8)3-7-2-4;6-10(7,8)5-1-3-9-4-2-5/h1-3,8H;1-4H2,(H,6,7,8).
What are the key properties of 5-bromopyridin-3-ol;morpholine-4-sulfonic acid?
5-bromopyridin-3-ol;morpholine-4-sulfonic acid has a molecular weight of 341.18 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopyridin-3-ol;morpholine-4-sulfonic acid is sourced from PubChem (CID 174717058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).