About benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one
benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one (PubChem CID 174717433) has the molecular formula C20H23NOS
and a molecular weight of 325.48 g/mol. Its IUPAC name is benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one |
| PubChem CID | 174717433 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(-c2ccccc2C(C)C)c1C.c1ccccc1 |
| InChI | InChI=1S/C14H17NOS.C6H6/c1-9(2)12-7-5-6-8-13(12)15-10(3)11(4)17-14(15)16;1-2-4-6-5-3-1/h5-9H,1-4H3;1-6H |
| InChIKey | XPDFXPLEMMNNJS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one?
The IUPAC name of benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one (CID 174717433) is benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one.
What is the SMILES notation for benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one?
The canonical SMILES for benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one is Cc1sc(=O)n(-c2ccccc2C(C)C)c1C.c1ccccc1.
What is the InChIKey of benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one?
The InChIKey is XPDFXPLEMMNNJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NOS.C6H6/c1-9(2)12-7-5-6-8-13(12)15-10(3)11(4)17-14(15)16;1-2-4-6-5-3-1/h5-9H,1-4H3;1-6H.
What are the key properties of benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one?
benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one has a molecular weight of 325.48 g/mol, XLogP of 5.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4,5-dimethyl-3-(2-propan-2-ylphenyl)-1,3-thiazol-2-one is sourced from PubChem (CID 174717433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).