About 3-(2-chlorophenyl)-2H-1,3-thiazole
3-(2-chlorophenyl)-2H-1,3-thiazole (PubChem CID 174717593) has the molecular formula C9H8ClNS
and a molecular weight of 197.69 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-2H-1,3-thiazole |
| PubChem CID | 174717593 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 3-(2-chlorophenyl)-2H-1,3-thiazole |
| SMILES | Clc1ccccc1N1C=CSC1 |
| InChI | InChI=1S/C9H8ClNS/c10-8-3-1-2-4-9(8)11-5-6-12-7-11/h1-6H,7H2 |
| InChIKey | HGTYUFGWWGHNHK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-chlorophenyl)-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-2H-1,3-thiazole?
The IUPAC name of 3-(2-chlorophenyl)-2H-1,3-thiazole (CID 174717593) is 3-(2-chlorophenyl)-2H-1,3-thiazole.
What is the SMILES notation for 3-(2-chlorophenyl)-2H-1,3-thiazole?
The canonical SMILES for 3-(2-chlorophenyl)-2H-1,3-thiazole is Clc1ccccc1N1C=CSC1.
What is the InChIKey of 3-(2-chlorophenyl)-2H-1,3-thiazole?
The InChIKey is HGTYUFGWWGHNHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNS/c10-8-3-1-2-4-9(8)11-5-6-12-7-11/h1-6H,7H2.
What are the key properties of 3-(2-chlorophenyl)-2H-1,3-thiazole?
3-(2-chlorophenyl)-2H-1,3-thiazole has a molecular weight of 197.69 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-2H-1,3-thiazole is sourced from PubChem (CID 174717593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).