C30H26 — CID 174718447
1,2-dihydroacenaphthylene;3,4,5,11-tetrahydrochrysene (PubChem CID 174718447) has the molecular formula C30H26 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1,2-dihydroacenaphthylene;3,4,5,11-tetrahydrochrysene.
| Compound Name | 1,2-dihydroacenaphthylene;3,4,5,11-tetrahydrochrysene |
|---|---|
| PubChem CID | 174718447 |
| Molecular Formula | C30H26 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1,2-dihydroacenaphthylene;3,4,5,11-tetrahydrochrysene |
| SMILES | C1=CC2=CCC3=c4ccccc4=CCC3=C2CC1.c1cc2c3c(cccc3c1)CC2 |
| InChI | InChI=1S/C18H16.C12H10/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-3,5-7,9-10H,4,8,11-12H2;1-6H,7-8H2 |
| InChIKey | JSOBVLASPBDAGT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |