About 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium
3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium (PubChem CID 174718460) has the molecular formula C11H18O4Zr
and a molecular weight of 305.49 g/mol. Its IUPAC name is 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium.
Molecular Properties
| Compound Name | 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium |
| PubChem CID | 174718460 |
| Molecular Formula | C11H18O4Zr |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium |
| SMILES | CC(=O)C(OC(C)(C)C)(C(C)=O)C(C)=O.[Zr] |
| InChI | InChI=1S/C11H18O4.Zr/c1-7(12)11(8(2)13,9(3)14)15-10(4,5)6;/h1-6H3; |
| InChIKey | KOUVKUIXSWXFOF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium?
The IUPAC name of 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium (CID 174718460) is 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium.
What is the SMILES notation for 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium?
The canonical SMILES for 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium is CC(=O)C(OC(C)(C)C)(C(C)=O)C(C)=O.[Zr].
What is the InChIKey of 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium?
The InChIKey is KOUVKUIXSWXFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4.Zr/c1-7(12)11(8(2)13,9(3)14)15-10(4,5)6;/h1-6H3;.
What are the key properties of 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium?
3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium has a molecular weight of 305.49 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-3-[(2-methylpropan-2-yl)oxy]pentane-2,4-dione;zirconium is sourced from PubChem (CID 174718460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).