C17H26F2O3Si — CID 174718664
3-(3,5-difluorophenyl)-1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174718664) has the molecular formula C17H26F2O3Si and a molecular weight of 344.47 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-1,1,2-trimethoxy-2-propylsilinane.
| Compound Name | 3-(3,5-difluorophenyl)-1,1,2-trimethoxy-2-propylsilinane |
|---|---|
| PubChem CID | 174718664 |
| Molecular Formula | C17H26F2O3Si |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-(3,5-difluorophenyl)-1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)C(c2cc(F)cc(F)c2)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C17H26F2O3Si/c1-5-8-17(20-2)16(7-6-9-23(17,21-3)22-4)13-10-14(18)12-15(19)11-13/h10-12,16H,5-9H2,1-4H3 |
| InChIKey | GEEVRYRKIGJQGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|