C12H16Br2 — CID 174718861
2-(2,2-dibromoethyl)-1,3,4,5-tetramethylbenzene (PubChem CID 174718861) has the molecular formula C12H16Br2 and a molecular weight of 320.07 g/mol. Its IUPAC name is 2-(2,2-dibromoethyl)-1,3,4,5-tetramethylbenzene.
| Compound Name | 2-(2,2-dibromoethyl)-1,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 174718861 |
| Molecular Formula | C12H16Br2 |
| Molecular Weight | 320.07 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 2-(2,2-dibromoethyl)-1,3,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(CC(Br)Br)c(C)c1C |
| InChI | InChI=1S/C12H16Br2/c1-7-5-8(2)11(6-12(13)14)10(4)9(7)3/h5,12H,6H2,1-4H3 |
| InChIKey | SVOAKSCQIUYWIE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|