About 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine
2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine (PubChem CID 174719068) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine.
Molecular Properties
| Compound Name | 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine |
| PubChem CID | 174719068 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine |
| SMILES | CC1=COC(C)(c2ccn[nH]2)C=N1 |
| InChI | InChI=1S/C9H11N3O/c1-7-5-13-9(2,6-10-7)8-3-4-11-12-8/h3-6H,1-2H3,(H,11,12) |
| InChIKey | MFOZYRYSECJXIT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine?
The IUPAC name of 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine (CID 174719068) is 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine.
What is the SMILES notation for 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine?
The canonical SMILES for 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine is CC1=COC(C)(c2ccn[nH]2)C=N1.
What is the InChIKey of 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine?
The InChIKey is MFOZYRYSECJXIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-7-5-13-9(2,6-10-7)8-3-4-11-12-8/h3-6H,1-2H3,(H,11,12).
What are the key properties of 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine?
2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine has a molecular weight of 177.21 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-2-(1H-pyrazol-5-yl)-1,4-oxazine is sourced from PubChem (CID 174719068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).