About 1,2-dimethylpyrrolidine;methanesulfonic acid
1,2-dimethylpyrrolidine;methanesulfonic acid (PubChem CID 174719075) has the molecular formula C7H17NO3S
and a molecular weight of 195.28 g/mol. Its IUPAC name is 1,2-dimethylpyrrolidine;methanesulfonic acid.
Molecular Properties
| Compound Name | 1,2-dimethylpyrrolidine;methanesulfonic acid |
| PubChem CID | 174719075 |
| Molecular Formula | C7H17NO3S |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1,2-dimethylpyrrolidine;methanesulfonic acid |
| SMILES | CC1CCCN1C.CS(=O)(=O)O |
| InChI | InChI=1S/C6H13N.CH4O3S/c1-6-4-3-5-7(6)2;1-5(2,3)4/h6H,3-5H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | YHQIMEJVOBMHAL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpyrrolidine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpyrrolidine;methanesulfonic acid?
The IUPAC name of 1,2-dimethylpyrrolidine;methanesulfonic acid (CID 174719075) is 1,2-dimethylpyrrolidine;methanesulfonic acid.
What is the SMILES notation for 1,2-dimethylpyrrolidine;methanesulfonic acid?
The canonical SMILES for 1,2-dimethylpyrrolidine;methanesulfonic acid is CC1CCCN1C.CS(=O)(=O)O.
What is the InChIKey of 1,2-dimethylpyrrolidine;methanesulfonic acid?
The InChIKey is YHQIMEJVOBMHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.CH4O3S/c1-6-4-3-5-7(6)2;1-5(2,3)4/h6H,3-5H2,1-2H3;1H3,(H,2,3,4).
What are the key properties of 1,2-dimethylpyrrolidine;methanesulfonic acid?
1,2-dimethylpyrrolidine;methanesulfonic acid has a molecular weight of 195.28 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpyrrolidine;methanesulfonic acid is sourced from PubChem (CID 174719075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).